C28H28N2O4 — CID 131855743
(E)-1,4-diphenylbut-2-ene-1,4-dione;methyl 1-phenylpiperazine-2-carboxylate (PubChem CID 131855743) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is (E)-1,4-diphenylbut-2-ene-1,4-dione;methyl 1-phenylpiperazine-2-carboxylate.
| Compound Name | (E)-1,4-diphenylbut-2-ene-1,4-dione;methyl 1-phenylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 131855743 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (E)-1,4-diphenylbut-2-ene-1,4-dione;methyl 1-phenylpiperazine-2-carboxylate |
| SMILES | COC(=O)C1CNCCN1c1ccccc1.O=C(/C=C/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12O2.C12H16N2O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14;1-16-12(15)11-9-13-7-8-14(11)10-5-3-2-4-6-10/h1-12H;2-6,11,13H,7-9H2,1H3/b12-11+; |
| InChIKey | UMUWZYPVPCLYIN-CALJPSDSSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|