C23H33N5O7 — CID 56999943
(2S)-2-[[(2S)-2-[[(2S)-3-methyl-2-[(1-phenylpiperazine-2-carbonyl)amino]butanoyl]amino]propanoyl]amino]butanedioic acid (PubChem CID 56999943) has the molecular formula C23H33N5O7 and a molecular weight of 491.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-3-methyl-2-[(1-phenylpiperazine-2-carbonyl)amino]butanoyl]amino]propanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-3-methyl-2-[(1-phenylpiperazine-2-carbonyl)amino]butanoyl]amino]propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 56999943 |
| Molecular Formula | C23H33N5O7 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-3-methyl-2-[(1-phenylpiperazine-2-carbonyl)amino]butanoyl]amino]propanoyl]amino]butanedioic acid |
| SMILES | CC(C)[C@H](NC(=O)C1CNCCN1c1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H33N5O7/c1-13(2)19(22(33)25-14(3)20(31)26-16(23(34)35)11-18(29)30)27-21(32)17-12-24-9-10-28(17)15-7-5-4-6-8-15/h4-8,13-14,16-17,19,24H,9-12H2,1-3H3,(H,25,33)(H,26,31)(H,27,32)(H,29,30)(H,34,35)/t14-,16-,17?,19-/m0/s1 |
| InChIKey | NLUASHLUHYHHDK-BYURATGHSA-N |
| XLogP | -0.85 |
| TPSA | 177.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |