C19H25N3O7 — CID 67476911
(2S)-2-[[3-phenyl-2-[[(2S)-2-(propanoylamino)propanoyl]amino]propanoyl]amino]butanedioic acid (PubChem CID 67476911) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is (2S)-2-[[3-phenyl-2-[[(2S)-2-(propanoylamino)propanoyl]amino]propanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[3-phenyl-2-[[(2S)-2-(propanoylamino)propanoyl]amino]propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 67476911 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2S)-2-[[3-phenyl-2-[[(2S)-2-(propanoylamino)propanoyl]amino]propanoyl]amino]butanedioic acid |
| SMILES | CCC(=O)N[C@@H](C)C(=O)NC(Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H25N3O7/c1-3-15(23)20-11(2)17(26)21-13(9-12-7-5-4-6-8-12)18(27)22-14(19(28)29)10-16(24)25/h4-8,11,13-14H,3,9-10H2,1-2H3,(H,20,23)(H,21,26)(H,22,27)(H,24,25)(H,28,29)/t11-,13?,14-/m0/s1 |
| InChIKey | ZBJASVXTHIKJJV-UFPXDFCQSA-N |
| XLogP | -0.33 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |