C22H28O4Si2 — CID 101127569
dimethyl (E)-2,3-bis[dimethyl(phenyl)silyl]but-2-enedioate (PubChem CID 101127569) has the molecular formula C22H28O4Si2 and a molecular weight of 412.63 g/mol. Its IUPAC name is dimethyl (E)-2,3-bis[dimethyl(phenyl)silyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2,3-bis[dimethyl(phenyl)silyl]but-2-enedioate |
|---|---|
| PubChem CID | 101127569 |
| Molecular Formula | C22H28O4Si2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | dimethyl (E)-2,3-bis[dimethyl(phenyl)silyl]but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H28O4Si2/c1-25-21(23)19(27(3,4)17-13-9-7-10-14-17)20(22(24)26-2)28(5,6)18-15-11-8-12-16-18/h7-16H,1-6H3/b20-19+ |
| InChIKey | GTSDMGXCJYAQPG-FMQUCBEESA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|