C30H38O10Si2 — CID 177491638
tetramethyl (1Z,3E)-1,4-bis[(4-methoxyphenyl)-dimethylsilyl]buta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 177491638) has the molecular formula C30H38O10Si2 and a molecular weight of 614.80 g/mol. Its IUPAC name is tetramethyl (1Z,3E)-1,4-bis[(4-methoxyphenyl)-dimethylsilyl]buta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl (1Z,3E)-1,4-bis[(4-methoxyphenyl)-dimethylsilyl]buta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 177491638 |
| Molecular Formula | C30H38O10Si2 |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | tetramethyl (1Z,3E)-1,4-bis[(4-methoxyphenyl)-dimethylsilyl]buta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C(=C(/C(=O)OC)[Si](C)(C)c1ccc(OC)cc1)/C(C(=O)OC)=C(/C(=O)OC)[Si](C)(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H38O10Si2/c1-35-19-11-15-21(16-12-19)41(7,8)25(29(33)39-5)23(27(31)37-3)24(28(32)38-4)26(30(34)40-6)42(9,10)22-17-13-20(36-2)14-18-22/h11-18H,1-10H3/b25-23-,26-24+ |
| InChIKey | JOWLJMVHKBTNNQ-MJPLYFDISA-N |
| XLogP | 2.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|