C20H18O7 — CID 177419239
1-O,2-O-dimethyl 1-O-phenyl (Z)-2-(4-methoxyphenyl)ethene-1,1,2-tricarboxylate (PubChem CID 177419239) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 1-O,2-O-dimethyl 1-O-phenyl (Z)-2-(4-methoxyphenyl)ethene-1,1,2-tricarboxylate.
| Compound Name | 1-O,2-O-dimethyl 1-O-phenyl (Z)-2-(4-methoxyphenyl)ethene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 177419239 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-O,2-O-dimethyl 1-O-phenyl (Z)-2-(4-methoxyphenyl)ethene-1,1,2-tricarboxylate |
| SMILES | COC(=O)/C(C(=O)Oc1ccccc1)=C(/C(=O)OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18O7/c1-24-14-11-9-13(10-12-14)16(18(21)25-2)17(19(22)26-3)20(23)27-15-7-5-4-6-8-15/h4-12H,1-3H3/b17-16- |
| InChIKey | IEJCCRSKAOBVDH-MSUUIHNZSA-N |
| XLogP | 2.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|