About 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate
1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate (PubChem CID 177473997) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate |
| PubChem CID | 177473997 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate |
| SMILES | COC(=O)/C(C(=O)Oc1ccccc1)=C(/C)Nc1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c1-13(19-14-9-5-3-6-10-14)16(17(20)22-2)18(21)23-15-11-7-4-8-12-15/h3-12,19H,1-2H3/b16-13+ |
| InChIKey | RYUIHUVLDTYJLH-DTQAZKPQSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate?
The IUPAC name of 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate (CID 177473997) is 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate.
What is the SMILES notation for 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate?
The canonical SMILES for 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate is COC(=O)/C(C(=O)Oc1ccccc1)=C(/C)Nc1ccccc1.
What is the InChIKey of 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate?
The InChIKey is RYUIHUVLDTYJLH-DTQAZKPQSA-N. The full InChI is InChI=1S/C18H17NO4/c1-13(19-14-9-5-3-6-10-14)16(17(20)22-2)18(21)23-15-11-7-4-8-12-15/h3-12,19H,1-2H3/b16-13+.
What are the key properties of 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate?
1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate has a molecular weight of 311.34 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 3-O-phenyl (2E)-2-(1-anilinoethylidene)propanedioate is sourced from PubChem (CID 177473997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).