C22H42O4Si4 — CID 10624664
methyl 4-(4-methoxyphenyl)-2-methylidene-4-tris(trimethylsilyl)silyloxybutanoate (PubChem CID 10624664) has the molecular formula C22H42O4Si4 and a molecular weight of 482.92 g/mol. Its IUPAC name is methyl 4-(4-methoxyphenyl)-2-methylidene-4-tris(trimethylsilyl)silyloxybutanoate.
| Compound Name | methyl 4-(4-methoxyphenyl)-2-methylidene-4-tris(trimethylsilyl)silyloxybutanoate |
|---|---|
| PubChem CID | 10624664 |
| Molecular Formula | C22H42O4Si4 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | methyl 4-(4-methoxyphenyl)-2-methylidene-4-tris(trimethylsilyl)silyloxybutanoate |
| SMILES | C=C(CC(O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)c1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C22H42O4Si4/c1-18(22(23)25-3)17-21(19-13-15-20(24-2)16-14-19)26-30(27(4,5)6,28(7,8)9)29(10,11)12/h13-16,21H,1,17H2,2-12H3 |
| InChIKey | KLAUOOKIUONPMX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|