C19H21NO10 — CID 54720956
tetramethyl 1-hydroxy-4-(4-methoxyanilino)buta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 54720956) has the molecular formula C19H21NO10 and a molecular weight of 423.37 g/mol. Its IUPAC name is tetramethyl 1-hydroxy-4-(4-methoxyanilino)buta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 1-hydroxy-4-(4-methoxyanilino)buta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 54720956 |
| Molecular Formula | C19H21NO10 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | tetramethyl 1-hydroxy-4-(4-methoxyanilino)buta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C(O)=C(C(=O)OC)C(C(=O)OC)=C(Nc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C19H21NO10/c1-26-11-8-6-10(7-9-11)20-14(18(24)29-4)12(16(22)27-2)13(17(23)28-3)15(21)19(25)30-5/h6-9,20-21H,1-5H3 |
| InChIKey | TZIGHOXIFQFGQC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|