C24H28O5Si2 — CID 101059317
dimethyl 2,5-bis[dimethyl(phenyl)silyl]furan-3,4-dicarboxylate (PubChem CID 101059317) has the molecular formula C24H28O5Si2 and a molecular weight of 452.66 g/mol. Its IUPAC name is dimethyl 2,5-bis[dimethyl(phenyl)silyl]furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis[dimethyl(phenyl)silyl]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101059317 |
| Molecular Formula | C24H28O5Si2 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | dimethyl 2,5-bis[dimethyl(phenyl)silyl]furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c([Si](C)(C)c2ccccc2)oc([Si](C)(C)c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C24H28O5Si2/c1-27-21(25)19-20(22(26)28-2)24(31(5,6)18-15-11-8-12-16-18)29-23(19)30(3,4)17-13-9-7-10-14-17/h7-16H,1-6H3 |
| InChIKey | GVRDTFCZPMSKLX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|