C28H34O8Si2 — CID 177480244
tetramethyl (1Z,3E)-1,4-bis[dimethyl(phenyl)silyl]buta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 177480244) has the molecular formula C28H34O8Si2 and a molecular weight of 554.74 g/mol. Its IUPAC name is tetramethyl (1Z,3E)-1,4-bis[dimethyl(phenyl)silyl]buta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl (1Z,3E)-1,4-bis[dimethyl(phenyl)silyl]buta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 177480244 |
| Molecular Formula | C28H34O8Si2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | tetramethyl (1Z,3E)-1,4-bis[dimethyl(phenyl)silyl]buta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C(=C(/C(=O)OC)[Si](C)(C)c1ccccc1)/C(C(=O)OC)=C(/C(=O)OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H34O8Si2/c1-33-25(29)21(23(27(31)35-3)37(5,6)19-15-11-9-12-16-19)22(26(30)34-2)24(28(32)36-4)38(7,8)20-17-13-10-14-18-20/h9-18H,1-8H3/b23-21-,24-22+ |
| InChIKey | FLFYTOWVQFNZJX-MMUCEYJRSA-N |
| XLogP | 2.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|