C24H18O5 — CID 10883558
methyl 2-(1,3-benzodioxol-5-yl)-4-phenyl-2H-chromene-3-carboxylate (PubChem CID 10883558) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yl)-4-phenyl-2H-chromene-3-carboxylate.
| Compound Name | methyl 2-(1,3-benzodioxol-5-yl)-4-phenyl-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 10883558 |
| Molecular Formula | C24H18O5 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | methyl 2-(1,3-benzodioxol-5-yl)-4-phenyl-2H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)c2ccccc2OC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H18O5/c1-26-24(25)22-21(15-7-3-2-4-8-15)17-9-5-6-10-18(17)29-23(22)16-11-12-19-20(13-16)28-14-27-19/h2-13,23H,14H2,1H3 |
| InChIKey | HGBZSBHCYOVCQA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |