C31H40O7 — CID 10885878
methyl 2-(1,3-benzodioxol-5-yl)-4-decoxy-6-propan-2-yloxy-2H-chromene-3-carboxylate (PubChem CID 10885878) has the molecular formula C31H40O7 and a molecular weight of 524.65 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-yl)-4-decoxy-6-propan-2-yloxy-2H-chromene-3-carboxylate.
| Compound Name | methyl 2-(1,3-benzodioxol-5-yl)-4-decoxy-6-propan-2-yloxy-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 10885878 |
| Molecular Formula | C31H40O7 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | methyl 2-(1,3-benzodioxol-5-yl)-4-decoxy-6-propan-2-yloxy-2H-chromene-3-carboxylate |
| SMILES | CCCCCCCCCCOC1=C(C(=O)OC)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 |
| InChI | InChI=1S/C31H40O7/c1-5-6-7-8-9-10-11-12-17-34-30-24-19-23(37-21(2)3)14-16-25(24)38-29(28(30)31(32)33-4)22-13-15-26-27(18-22)36-20-35-26/h13-16,18-19,21,29H,5-12,17,20H2,1-4H3 |
| InChIKey | NJGCKIHYQRYOQT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|