C33H34O7 — CID 10940517
methyl 4-(1,3-benzodioxol-5-yl)-6-butoxy-2-(4-cyclopentyloxyphenyl)-2H-chromene-3-carboxylate (PubChem CID 10940517) has the molecular formula C33H34O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxol-5-yl)-6-butoxy-2-(4-cyclopentyloxyphenyl)-2H-chromene-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzodioxol-5-yl)-6-butoxy-2-(4-cyclopentyloxyphenyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 10940517 |
| Molecular Formula | C33H34O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | methyl 4-(1,3-benzodioxol-5-yl)-6-butoxy-2-(4-cyclopentyloxyphenyl)-2H-chromene-3-carboxylate |
| SMILES | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)OC)C(c1ccc(OC3CCCC3)cc1)O2 |
| InChI | InChI=1S/C33H34O7/c1-3-4-17-36-25-14-16-27-26(19-25)30(22-11-15-28-29(18-22)38-20-37-28)31(33(34)35-2)32(40-27)21-9-12-24(13-10-21)39-23-7-5-6-8-23/h9-16,18-19,23,32H,3-8,17,20H2,1-2H3 |
| InChIKey | APKDGXXKLDPVDM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|