C21H18O6 — CID 10155767
methyl 1-(1,3-benzodioxol-5-yl)-3-oxo-5-propoxyindene-2-carboxylate (PubChem CID 10155767) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 1-(1,3-benzodioxol-5-yl)-3-oxo-5-propoxyindene-2-carboxylate.
| Compound Name | methyl 1-(1,3-benzodioxol-5-yl)-3-oxo-5-propoxyindene-2-carboxylate |
|---|---|
| PubChem CID | 10155767 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 1-(1,3-benzodioxol-5-yl)-3-oxo-5-propoxyindene-2-carboxylate |
| SMILES | CCCOc1ccc2c(c1)C(=O)C(C(=O)OC)=C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18O6/c1-3-8-25-13-5-6-14-15(10-13)20(22)19(21(23)24-2)18(14)12-4-7-16-17(9-12)27-11-26-16/h4-7,9-10H,3,8,11H2,1-2H3 |
| InChIKey | VAOOIYMZYHSZLT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|