C17H17NO3 — CID 132536565
methyl (6R,8S)-8-methyl-5-oxo-8-phenyl-6,7-dihydroindolizine-6-carboxylate (PubChem CID 132536565) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl (6R,8S)-8-methyl-5-oxo-8-phenyl-6,7-dihydroindolizine-6-carboxylate.
| Compound Name | methyl (6R,8S)-8-methyl-5-oxo-8-phenyl-6,7-dihydroindolizine-6-carboxylate |
|---|---|
| PubChem CID | 132536565 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl (6R,8S)-8-methyl-5-oxo-8-phenyl-6,7-dihydroindolizine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@](C)(c2ccccc2)c2cccn2C1=O |
| InChI | InChI=1S/C17H17NO3/c1-17(12-7-4-3-5-8-12)11-13(16(20)21-2)15(19)18-10-6-9-14(17)18/h3-10,13H,11H2,1-2H3/t13-,17+/m1/s1 |
| InChIKey | AQSLGMTYOXUPNQ-DYVFJYSZSA-N |
| XLogP | 2.63 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|