C13H8N4O5 — CID 22298159
cis-ethyl (1R,3S)-1,2,2-tricyano-3-(5-nitrofuran-2-yl)cyclopropane-1-carboxylate (PubChem CID 22298159) has the molecular formula C13H8N4O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is cis-ethyl (1R,3S)-1,2,2-tricyano-3-(5-nitrofuran-2-yl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,3S)-1,2,2-tricyano-3-(5-nitrofuran-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 22298159 |
| Molecular Formula | C13H8N4O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | cis-ethyl (1R,3S)-1,2,2-tricyano-3-(5-nitrofuran-2-yl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)[C@@H](c2ccc([N+](=O)[O-])o2)C1(C#N)C#N |
| InChI | InChI=1S/C13H8N4O5/c1-2-21-11(18)13(7-16)10(12(13,5-14)6-15)8-3-4-9(22-8)17(19)20/h3-4,10H,2H2,1H3/t10-,13-/m0/s1 |
| InChIKey | FZQJGEXZIDQBTQ-GWCFXTLKSA-N |
| XLogP | 1.39 |
| TPSA | 153.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|