C12H13N5O7 — CID 135456371
ethyl 6-methyl-4-(5-nitrofuran-2-yl)-2-nitroimino-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 135456371) has the molecular formula C12H13N5O7 and a molecular weight of 339.26 g/mol. Its IUPAC name is ethyl 6-methyl-4-(5-nitrofuran-2-yl)-2-nitroimino-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-4-(5-nitrofuran-2-yl)-2-nitroimino-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135456371 |
| Molecular Formula | C12H13N5O7 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl 6-methyl-4-(5-nitrofuran-2-yl)-2-nitroimino-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=N[N+](=O)[O-])NC1c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H13N5O7/c1-3-23-11(18)9-6(2)13-12(15-17(21)22)14-10(9)7-4-5-8(24-7)16(19)20/h4-5,10H,3H2,1-2H3,(H2,13,14,15) |
| InChIKey | CDIFCCBCWMCEGR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|