C20H21N3O6 — CID 92860981
ethyl (4S)-4-[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 92860981) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is ethyl (4S)-4-[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 92860981 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | ethyl (4S)-4-[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccc(-c2cc(C)c([N+](=O)[O-])cc2C)o1 |
| InChI | InChI=1S/C20H21N3O6/c1-5-28-19(24)17-12(4)21-20(25)22-18(17)16-7-6-15(29-16)13-8-11(3)14(23(26)27)9-10(13)2/h6-9,18H,5H2,1-4H3,(H2,21,22,25)/t18-/m1/s1 |
| InChIKey | TXIBFEQAEATWDL-GOSISDBHSA-N |
| XLogP | 3.66 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|