C18H16N4O7 — CID 2962641
methyl 2-[[6-methyl-4-(5-nitrofuran-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 2962641) has the molecular formula C18H16N4O7 and a molecular weight of 400.35 g/mol. Its IUPAC name is methyl 2-[[6-methyl-4-(5-nitrofuran-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[6-methyl-4-(5-nitrofuran-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2962641 |
| Molecular Formula | C18H16N4O7 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | methyl 2-[[6-methyl-4-(5-nitrofuran-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1=C(C)NC(=O)NC1c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H16N4O7/c1-9-14(16(23)20-11-6-4-3-5-10(11)17(24)28-2)15(21-18(25)19-9)12-7-8-13(29-12)22(26)27/h3-8,15H,1-2H3,(H,20,23)(H2,19,21,25) |
| InChIKey | ROIYMDZJJLRBEP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|