C15H15N3O5 — CID 91422778
ethyl 3-cyano-2,6-dimethyl-4-(5-nitrofuran-2-yl)-3,4-dihydropyridine-5-carboxylate (PubChem CID 91422778) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is ethyl 3-cyano-2,6-dimethyl-4-(5-nitrofuran-2-yl)-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 3-cyano-2,6-dimethyl-4-(5-nitrofuran-2-yl)-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 91422778 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 3-cyano-2,6-dimethyl-4-(5-nitrofuran-2-yl)-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C#N)C1c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H15N3O5/c1-4-22-15(19)13-9(3)17-8(2)10(7-16)14(13)11-5-6-12(23-11)18(20)21/h5-6,10,14H,4H2,1-3H3 |
| InChIKey | PGNOLPPVHMNBRX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 118.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|