C10H9N3O6S — CID 116700278
ethyl 5-[(5-nitrofuran-2-yl)methylsulfanyl]-1,3,4-oxadiazole-2-carboxylate (PubChem CID 116700278) has the molecular formula C10H9N3O6S and a molecular weight of 299.26 g/mol. Its IUPAC name is ethyl 5-[(5-nitrofuran-2-yl)methylsulfanyl]-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-[(5-nitrofuran-2-yl)methylsulfanyl]-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 116700278 |
| Molecular Formula | C10H9N3O6S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | ethyl 5-[(5-nitrofuran-2-yl)methylsulfanyl]-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(SCc2ccc([N+](=O)[O-])o2)o1 |
| InChI | InChI=1S/C10H9N3O6S/c1-2-17-9(14)8-11-12-10(19-8)20-5-6-3-4-7(18-6)13(15)16/h3-4H,2,5H2,1H3 |
| InChIKey | YSLFYLPYRSGHDL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 121.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|