C9H7N3O3 — CID 67815214
4-(4-nitrophenyl)-1,4-dihydroimidazol-5-one (PubChem CID 67815214) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,4-dihydroimidazol-5-one.
| Compound Name | 4-(4-nitrophenyl)-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 67815214 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-(4-nitrophenyl)-1,4-dihydroimidazol-5-one |
| SMILES | O=C1NC=NC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7N3O3/c13-9-8(10-5-11-9)6-1-3-7(4-2-6)12(14)15/h1-5,8H,(H,10,11,13) |
| InChIKey | XCATZMJGXAFMLA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|