C24H34N5O4+ — CID 73327935
7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione (PubChem CID 73327935) has the molecular formula C24H34N5O4+ and a molecular weight of 456.57 g/mol. Its IUPAC name is 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione.
| Compound Name | 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 73327935 |
| Molecular Formula | C24H34N5O4+ |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione |
| SMILES | Cc1ccc(OCC(O)CN2/C(=[N+]3\CCCC(C)C3)N=C3C2C(=O)N(C)C(=O)N3C)cc1C |
| InChI | InChI=1S/C24H34N5O4/c1-15-7-6-10-28(12-15)23-25-21-20(22(31)27(5)24(32)26(21)4)29(23)13-18(30)14-33-19-9-8-16(2)17(3)11-19/h8-9,11,15,18,20,30H,6-7,10,12-14H2,1-5H3/q+1 |
| InChIKey | UQYLUENLLISXKE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|