C20H33NO3 — CID 16800327
1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol (PubChem CID 16800327) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 16800327 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol |
| SMILES | Cc1ccc(OCCOCC(O)CN2C(C)CCCC2C)cc1C |
| InChI | InChI=1S/C20H33NO3/c1-15-8-9-20(12-16(15)2)24-11-10-23-14-19(22)13-21-17(3)6-5-7-18(21)4/h8-9,12,17-19,22H,5-7,10-11,13-14H2,1-4H3 |
| InChIKey | UNOLXCZMMZMVKQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|