C19H32N2O4 — CID 18590108
1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol (PubChem CID 18590108) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 18590108 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)ethoxy]-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(OCCOCC(O)CN2CCN(CCO)CC2)cc1C |
| InChI | InChI=1S/C19H32N2O4/c1-16-3-4-19(13-17(16)2)25-12-11-24-15-18(23)14-21-7-5-20(6-8-21)9-10-22/h3-4,13,18,22-23H,5-12,14-15H2,1-2H3 |
| InChIKey | ZEXRYNYXUBNVCI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|