C20H33ClN2O5 — CID 16800328
ethyl 4-[3-[2-(3,4-dimethylphenoxy)ethoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride (PubChem CID 16800328) has the molecular formula C20H33ClN2O5 and a molecular weight of 416.95 g/mol. Its IUPAC name is ethyl 4-[3-[2-(3,4-dimethylphenoxy)ethoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride.
| Compound Name | ethyl 4-[3-[2-(3,4-dimethylphenoxy)ethoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 16800328 |
| Molecular Formula | C20H33ClN2O5 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | ethyl 4-[3-[2-(3,4-dimethylphenoxy)ethoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(CC(O)COCCOc2ccc(C)c(C)c2)CC1.Cl |
| InChI | InChI=1S/C20H32N2O5.ClH/c1-4-26-20(24)22-9-7-21(8-10-22)14-18(23)15-25-11-12-27-19-6-5-16(2)17(3)13-19;/h5-6,13,18,23H,4,7-12,14-15H2,1-3H3;1H |
| InChIKey | GCFRCSBPCQYJFN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|