C21H35NO3 — CID 100802798
(2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol (PubChem CID 100802798) has the molecular formula C21H35NO3 and a molecular weight of 349.51 g/mol. Its IUPAC name is (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 100802798 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol |
| SMILES | CC(C)c1ccc(OCCOC[C@H](O)CN2[C@@H](C)CCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C21H35NO3/c1-16(2)19-8-10-21(11-9-19)25-13-12-24-15-20(23)14-22-17(3)6-5-7-18(22)4/h8-11,16-18,20,23H,5-7,12-15H2,1-4H3/t17-,18-,20+/m0/s1 |
| InChIKey | OKDQYRMAQYYREX-CMKODMSKSA-N |
| XLogP | 3.83 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|