C20H33NO3 — CID 43865760
1-(azepan-1-yl)-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol (PubChem CID 43865760) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 43865760 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 1-(azepan-1-yl)-3-[2-(4-propan-2-ylphenoxy)ethoxy]propan-2-ol |
| SMILES | CC(C)c1ccc(OCCOCC(O)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H33NO3/c1-17(2)18-7-9-20(10-8-18)24-14-13-23-16-19(22)15-21-11-5-3-4-6-12-21/h7-10,17,19,22H,3-6,11-16H2,1-2H3 |
| InChIKey | BLJSRFQUGSVSHV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|