C22H28Cl2N5O4+ — CID 73328934
7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione (PubChem CID 73328934) has the molecular formula C22H28Cl2N5O4+ and a molecular weight of 497.40 g/mol. Its IUPAC name is 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione.
| Compound Name | 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 73328934 |
| Molecular Formula | C22H28Cl2N5O4+ |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 7-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-5H-purine-2,6-dione |
| SMILES | CC1CCC/[N+](=C2/N=C3C(C(=O)N(C)C(=O)N3C)N2CC(O)COc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C22H28Cl2N5O4/c1-13-5-4-8-28(10-13)21-25-19-18(20(31)27(3)22(32)26(19)2)29(21)11-15(30)12-33-17-7-6-14(23)9-16(17)24/h6-7,9,13,15,18,30H,4-5,8,10-12H2,1-3H3/q+1 |
| InChIKey | GEVUNIBJHDNRJR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|