C23H32N5O5+ — CID 78212711
8-(azepan-1-ium-1-ylidene)-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-5H-purine-2,6-dione (PubChem CID 78212711) has the molecular formula C23H32N5O5+ and a molecular weight of 458.54 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylidene)-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-5H-purine-2,6-dione.
| Compound Name | 8-(azepan-1-ium-1-ylidene)-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78212711 |
| Molecular Formula | C23H32N5O5+ |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 8-(azepan-1-ium-1-ylidene)-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-5H-purine-2,6-dione |
| SMILES | COc1ccc(OCC(O)CN2C(=[N+]3CCCCCC3)N=C3C2C(=O)N(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C23H32N5O5/c1-25-20-19(21(30)26(2)23(25)31)28(22(24-20)27-12-6-4-5-7-13-27)14-16(29)15-33-18-10-8-17(32-3)9-11-18/h8-11,16,19,29H,4-7,12-15H2,1-3H3/q+1 |
| InChIKey | QCRVZONTVJQDNO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|