C23H33N6O6+ — CID 73327893
7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-(2-morpholin-4-ylethylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 73327893) has the molecular formula C23H33N6O6+ and a molecular weight of 489.55 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-(2-morpholin-4-ylethylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-(2-morpholin-4-ylethylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73327893 |
| Molecular Formula | C23H33N6O6+ |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethyl-8-(2-morpholin-4-ylethylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | COc1ccc(OCC(O)C[N+]2=C(NCCN3CCOCC3)N=C3C2C(=O)N(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C23H32N6O6/c1-26-20-19(21(31)27(2)23(26)32)29(22(25-20)24-8-9-28-10-12-34-13-11-28)14-16(30)15-35-18-6-4-17(33-3)5-7-18/h4-7,16,19,30H,8-15H2,1-3H3/p+1 |
| InChIKey | OWJYKNOYNNFJLM-UHFFFAOYSA-O |
| XLogP | -0.97 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|