C22H27N6O4+ — CID 73259072
2,4,7-trimethyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73259072) has the molecular formula C22H27N6O4+ and a molecular weight of 439.50 g/mol. Its IUPAC name is 2,4,7-trimethyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 2,4,7-trimethyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73259072 |
| Molecular Formula | C22H27N6O4+ |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2,4,7-trimethyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(n1-c1ccc(OCCN3CCOCC3)cc1)N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C22H27N6O4/c1-15-14-27-18-19(24(2)22(30)25(3)20(18)29)23-21(27)28(15)16-4-6-17(7-5-16)32-13-10-26-8-11-31-12-9-26/h4-7,14,18H,8-13H2,1-3H3/q+1 |
| InChIKey | PHQBSPKWMFLPGD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|