C18H19N6O4+ — CID 73402169
2-[3-(2,4,7-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl)phenoxy]acetamide (PubChem CID 73402169) has the molecular formula C18H19N6O4+ and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-[3-(2,4,7-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl)phenoxy]acetamide.
| Compound Name | 2-[3-(2,4,7-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 73402169 |
| Molecular Formula | C18H19N6O4+ |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[3-(2,4,7-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl)phenoxy]acetamide |
| SMILES | Cc1c[n+]2c(n1-c1cccc(OCC(N)=O)c1)N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C18H18N6O4/c1-10-8-23-14-15(21(2)18(27)22(3)16(14)26)20-17(23)24(10)11-5-4-6-12(7-11)28-9-13(19)25/h4-8,14H,9H2,1-3H3,(H-,19,25)/p+1 |
| InChIKey | CTPJRXRSUIZSSY-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|