C21H27N6O4+ — CID 73402444
6-[3-(2,4-dimethoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73402444) has the molecular formula C21H27N6O4+ and a molecular weight of 427.49 g/mol. Its IUPAC name is 6-[3-(2,4-dimethoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-[3-(2,4-dimethoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73402444 |
| Molecular Formula | C21H27N6O4+ |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 6-[3-(2,4-dimethoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | COc1ccc(NCCCn2c(C)c[n+]3c2N=C2C3C(=O)N(C)C(=O)N2C)c(OC)c1 |
| InChI | InChI=1S/C21H27N6O4/c1-13-12-27-17-18(24(2)21(29)25(3)19(17)28)23-20(27)26(13)10-6-9-22-15-8-7-14(30-4)11-16(15)31-5/h7-8,11-12,17,22H,6,9-10H2,1-5H3/q+1 |
| InChIKey | XOLWOKZLNDIIML-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|