C21H27N6O4+ — CID 73394721
6-[2-(2,5-dimethoxyanilino)ethyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73394721) has the molecular formula C21H27N6O4+ and a molecular weight of 427.49 g/mol. Its IUPAC name is 6-[2-(2,5-dimethoxyanilino)ethyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-[2-(2,5-dimethoxyanilino)ethyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73394721 |
| Molecular Formula | C21H27N6O4+ |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 6-[2-(2,5-dimethoxyanilino)ethyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | COc1ccc(OC)c(NCC[n+]2c(C)c(C)n3c2N=C2C3C(=O)N(C)C(=O)N2C)c1 |
| InChI | InChI=1S/C21H27N6O4/c1-12-13(2)27-17-18(24(3)21(29)25(4)19(17)28)23-20(27)26(12)10-9-22-15-11-14(30-5)7-8-16(15)31-6/h7-8,11,17,22H,9-10H2,1-6H3/q+1 |
| InChIKey | VSVTZRPXYPMNMO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|