C18H28N5O3+ — CID 73281276
6-(2-methoxyethyl)-4,7,8-trimethyl-2-pentyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73281276) has the molecular formula C18H28N5O3+ and a molecular weight of 362.45 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-4,7,8-trimethyl-2-pentyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-(2-methoxyethyl)-4,7,8-trimethyl-2-pentyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73281276 |
| Molecular Formula | C18H28N5O3+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 6-(2-methoxyethyl)-4,7,8-trimethyl-2-pentyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | CCCCCN1C(=O)C2C(=Nc3n2c(C)c(C)[n+]3CCOC)N(C)C1=O |
| InChI | InChI=1S/C18H28N5O3/c1-6-7-8-9-22-16(24)14-15(20(4)18(22)25)19-17-21(10-11-26-5)12(2)13(3)23(14)17/h14H,6-11H2,1-5H3/q+1 |
| InChIKey | VKCKSLAZNKBQRT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|