C17H24N5O5+ — CID 73328405
methyl 2-[6-(2-methoxyethyl)-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]propanoate (PubChem CID 73328405) has the molecular formula C17H24N5O5+ and a molecular weight of 378.41 g/mol. Its IUPAC name is methyl 2-[6-(2-methoxyethyl)-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]propanoate.
| Compound Name | methyl 2-[6-(2-methoxyethyl)-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]propanoate |
|---|---|
| PubChem CID | 73328405 |
| Molecular Formula | C17H24N5O5+ |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl 2-[6-(2-methoxyethyl)-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]propanoate |
| SMILES | COCC[n+]1c(C)c(C)n2c1N=C1C2C(=O)N(C(C)C(=O)OC)C(=O)N1C |
| InChI | InChI=1S/C17H24N5O5/c1-9-10(2)21-12-13(18-16(21)20(9)7-8-26-5)19(4)17(25)22(14(12)23)11(3)15(24)27-6/h11-12H,7-8H2,1-6H3/q+1 |
| InChIKey | RHVHXJHXERTAAG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|