C14H18N5O3+ — CID 78305524
4,6,7,8-tetramethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 78305524) has the molecular formula C14H18N5O3+ and a molecular weight of 304.33 g/mol. Its IUPAC name is 4,6,7,8-tetramethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 4,6,7,8-tetramethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 78305524 |
| Molecular Formula | C14H18N5O3+ |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4,6,7,8-tetramethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | CC(=O)CN1C(=O)C2C(=Nc3n2c(C)c(C)[n+]3C)N(C)C1=O |
| InChI | InChI=1S/C14H18N5O3/c1-7(20)6-18-12(21)10-11(17(5)14(18)22)15-13-16(4)8(2)9(3)19(10)13/h10H,6H2,1-5H3/q+1 |
| InChIKey | JKLYFAKPAPGGEZ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|