C16H22N5O4+ — CID 78305489
methyl 2-(4,7,8-trimethyl-1,3-dioxo-6-propyl-9aH-purino[7,8-a]imidazol-6-ium-2-yl)acetate (PubChem CID 78305489) has the molecular formula C16H22N5O4+ and a molecular weight of 348.38 g/mol. Its IUPAC name is methyl 2-(4,7,8-trimethyl-1,3-dioxo-6-propyl-9aH-purino[7,8-a]imidazol-6-ium-2-yl)acetate.
| Compound Name | methyl 2-(4,7,8-trimethyl-1,3-dioxo-6-propyl-9aH-purino[7,8-a]imidazol-6-ium-2-yl)acetate |
|---|---|
| PubChem CID | 78305489 |
| Molecular Formula | C16H22N5O4+ |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 2-(4,7,8-trimethyl-1,3-dioxo-6-propyl-9aH-purino[7,8-a]imidazol-6-ium-2-yl)acetate |
| SMILES | CCC[n+]1c(C)c(C)n2c1N=C1C2C(=O)N(CC(=O)OC)C(=O)N1C |
| InChI | InChI=1S/C16H22N5O4/c1-6-7-19-9(2)10(3)21-12-13(17-15(19)21)18(4)16(24)20(14(12)23)8-11(22)25-5/h12H,6-8H2,1-5H3/q+1 |
| InChIKey | MSBVKQQLEUJRGG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|