C14H20N5O3+ — CID 78370935
6-(2-methoxyethyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 78370935) has the molecular formula C14H20N5O3+ and a molecular weight of 306.35 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-(2-methoxyethyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 78370935 |
| Molecular Formula | C14H20N5O3+ |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 6-(2-methoxyethyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | COCC[n+]1c(C)c(C)n2c1N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C14H20N5O3/c1-8-9(2)19-10-11(15-13(19)18(8)6-7-22-5)16(3)14(21)17(4)12(10)20/h10H,6-7H2,1-5H3/q+1 |
| InChIKey | WQWRDCRSDVMIDP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|