C24H31FN7O2+ — CID 73329132
6-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73329132) has the molecular formula C24H31FN7O2+ and a molecular weight of 468.56 g/mol. Its IUPAC name is 6-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73329132 |
| Molecular Formula | C24H31FN7O2+ |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 6-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | Cc1c(C)[n+](CCCN2CCN(c3ccc(F)cc3)CC2)c2n1C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C24H31FN7O2/c1-16-17(2)32-20-21(27(3)24(34)28(4)22(20)33)26-23(32)31(16)11-5-10-29-12-14-30(15-13-29)19-8-6-18(25)7-9-19/h6-9,20H,5,10-15H2,1-4H3/q+1 |
| InChIKey | UDHNIGQWRPYXCT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|