C27H31N6O3+ — CID 73281235
4,7,8-trimethyl-6-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73281235) has the molecular formula C27H31N6O3+ and a molecular weight of 487.58 g/mol. Its IUPAC name is 4,7,8-trimethyl-6-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 4,7,8-trimethyl-6-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73281235 |
| Molecular Formula | C27H31N6O3+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4,7,8-trimethyl-6-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | Cc1c(C)[n+](CCN2CCOCC2)c2n1C1C(=O)N(Cc3cccc4ccccc34)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C27H31N6O3/c1-18-19(2)33-23-24(28-26(33)31(18)12-11-30-13-15-36-16-14-30)29(3)27(35)32(25(23)34)17-21-9-6-8-20-7-4-5-10-22(20)21/h4-10,23H,11-17H2,1-3H3/q+1 |
| InChIKey | ZGRBPZBEQBBRMQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|