C24H31N6O3+ — CID 73328343
6-(2-ethylphenyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73328343) has the molecular formula C24H31N6O3+ and a molecular weight of 451.55 g/mol. Its IUPAC name is 6-(2-ethylphenyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(2-ethylphenyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73328343 |
| Molecular Formula | C24H31N6O3+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 6-(2-ethylphenyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | CCc1ccccc1-n1c(C)c(C)[n+]2c1N=C1C2C(=O)N(CCN2CCOCC2)C(=O)N1C |
| InChI | InChI=1S/C24H31N6O3/c1-5-18-8-6-7-9-19(18)29-16(2)17(3)30-20-21(25-23(29)30)26(4)24(32)28(22(20)31)11-10-27-12-14-33-15-13-27/h6-9,20H,5,10-15H2,1-4H3/q+1 |
| InChIKey | QSRPJDSWYVONGN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 74.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|