C22H33N6O3+ — CID 78369489
6-cyclohexyl-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 78369489) has the molecular formula C22H33N6O3+ and a molecular weight of 429.55 g/mol. Its IUPAC name is 6-cyclohexyl-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-cyclohexyl-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78369489 |
| Molecular Formula | C22H33N6O3+ |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 6-cyclohexyl-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c(C)[n+]2c(n1C1CCCCC1)N=C1C2C(=O)N(CCN2CCOCC2)C(=O)N1C |
| InChI | InChI=1S/C22H33N6O3/c1-15-16(2)28-18-19(23-21(28)27(15)17-7-5-4-6-8-17)24(3)22(30)26(20(18)29)10-9-25-11-13-31-14-12-25/h17-18H,4-14H2,1-3H3/q+1 |
| InChIKey | BHOKFDCEUVMLOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|