C23H35N6O2+ — CID 74476865
6-cyclohexyl-4,7,8-trimethyl-2-(2-piperidin-1-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 74476865) has the molecular formula C23H35N6O2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is 6-cyclohexyl-4,7,8-trimethyl-2-(2-piperidin-1-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-cyclohexyl-4,7,8-trimethyl-2-(2-piperidin-1-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 74476865 |
| Molecular Formula | C23H35N6O2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 6-cyclohexyl-4,7,8-trimethyl-2-(2-piperidin-1-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c(C)[n+]2c(n1C1CCCCC1)N=C1C2C(=O)N(CCN2CCCCC2)C(=O)N1C |
| InChI | InChI=1S/C23H35N6O2/c1-16-17(2)29-19-20(24-22(29)28(16)18-10-6-4-7-11-18)25(3)23(31)27(21(19)30)15-14-26-12-8-5-9-13-26/h18-19H,4-15H2,1-3H3/q+1 |
| InChIKey | LDXAIBTWUAIYDI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|