C20H28N5O4+ — CID 73284214
ethyl 3-(6-cyclohexyl-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)propanoate (PubChem CID 73284214) has the molecular formula C20H28N5O4+ and a molecular weight of 402.48 g/mol. Its IUPAC name is ethyl 3-(6-cyclohexyl-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)propanoate.
| Compound Name | ethyl 3-(6-cyclohexyl-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)propanoate |
|---|---|
| PubChem CID | 73284214 |
| Molecular Formula | C20H28N5O4+ |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | ethyl 3-(6-cyclohexyl-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)C2C(=Nc3n(C4CCCCC4)c(C)c[n+]32)N(C)C1=O |
| InChI | InChI=1S/C20H28N5O4/c1-4-29-15(26)10-11-23-18(27)16-17(22(3)20(23)28)21-19-24(16)12-13(2)25(19)14-8-6-5-7-9-14/h12,14,16H,4-11H2,1-3H3/q+1 |
| InChIKey | IXDOLGQEFZGELA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|