C21H22N5O5+ — CID 78370450
ethyl 4-[4,7-dimethyl-1,3-dioxo-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-6-yl]benzoate (PubChem CID 78370450) has the molecular formula C21H22N5O5+ and a molecular weight of 424.44 g/mol. Its IUPAC name is ethyl 4-[4,7-dimethyl-1,3-dioxo-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-6-yl]benzoate.
| Compound Name | ethyl 4-[4,7-dimethyl-1,3-dioxo-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-6-yl]benzoate |
|---|---|
| PubChem CID | 78370450 |
| Molecular Formula | C21H22N5O5+ |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 4-[4,7-dimethyl-1,3-dioxo-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-6-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)c[n+]3c2N=C2C3C(=O)N(CC(C)=O)C(=O)N2C)cc1 |
| InChI | InChI=1S/C21H22N5O5/c1-5-31-19(29)14-6-8-15(9-7-14)26-12(2)10-24-16-17(22-20(24)26)23(4)21(30)25(18(16)28)11-13(3)27/h6-10,16H,5,11H2,1-4H3/q+1 |
| InChIKey | SZSOSGPEWJZPNK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|