C17H25N6O4+ — CID 73328672
6-(2-hydroxyethyl)-4,7-dimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73328672) has the molecular formula C17H25N6O4+ and a molecular weight of 377.43 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-4,7-dimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(2-hydroxyethyl)-4,7-dimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73328672 |
| Molecular Formula | C17H25N6O4+ |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 6-(2-hydroxyethyl)-4,7-dimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(n1CCO)N=C1C2C(=O)N(CCN2CCOCC2)C(=O)N1C |
| InChI | InChI=1S/C17H25N6O4/c1-12-11-23-13-14(18-16(23)21(12)5-8-24)19(2)17(26)22(15(13)25)4-3-20-6-9-27-10-7-20/h11,13,24H,3-10H2,1-2H3/q+1 |
| InChIKey | GDBLJYAPZVDPIG-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 94.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|