C15H22N5O4+ — CID 73328374
2,6-bis(2-methoxyethyl)-4,7-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73328374) has the molecular formula C15H22N5O4+ and a molecular weight of 336.37 g/mol. Its IUPAC name is 2,6-bis(2-methoxyethyl)-4,7-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 2,6-bis(2-methoxyethyl)-4,7-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73328374 |
| Molecular Formula | C15H22N5O4+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,6-bis(2-methoxyethyl)-4,7-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | COCCN1C(=O)C2C(=Nc3n(CCOC)c(C)c[n+]32)N(C)C1=O |
| InChI | InChI=1S/C15H22N5O4/c1-10-9-20-11-12(16-14(20)18(10)5-7-23-3)17(2)15(22)19(13(11)21)6-8-24-4/h9,11H,5-8H2,1-4H3/q+1 |
| InChIKey | SCFDOXPYJRDREL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 80.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|